C26H16BrClN2O5S — CID 6172299
[4-[(Z)-[(5-bromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6172299) has the molecular formula C26H16BrClN2O5S and a molecular weight of 583.85 g/mol. Its IUPAC name is [4-[(Z)-[(5-bromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[(5-bromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6172299 |
| Molecular Formula | C26H16BrClN2O5S |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | [4-[(Z)-[(5-bromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)ccc3o2)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H16BrClN2O5S/c1-33-20-10-14(13-29-30-25(31)21-12-15-11-16(27)7-9-18(15)34-21)6-8-19(20)35-26(32)24-23(28)17-4-2-3-5-22(17)36-24/h2-13H,1H3,(H,30,31)/b29-13- |
| InChIKey | JTUGGVLBIIMKPX-DBFSUHOCSA-N |
| XLogP | 7.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|