C10H10F3N3OS — CID 168534303
[[2-methyl-5-(trifluoromethoxy)phenyl]methylideneamino]thiourea (PubChem CID 168534303) has the molecular formula C10H10F3N3OS and a molecular weight of 277.27 g/mol. Its IUPAC name is [[2-methyl-5-(trifluoromethoxy)phenyl]methylideneamino]thiourea.
| Compound Name | [[2-methyl-5-(trifluoromethoxy)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534303 |
| Molecular Formula | C10H10F3N3OS |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [[2-methyl-5-(trifluoromethoxy)phenyl]methylideneamino]thiourea |
| SMILES | Cc1ccc(OC(F)(F)F)cc1C=NNC(N)=S |
| InChI | InChI=1S/C10H10F3N3OS/c1-6-2-3-8(17-10(11,12)13)4-7(6)5-15-16-9(14)18/h2-5H,1H3,(H3,14,16,18) |
| InChIKey | JDLASCQNIHKUNP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|