C9H10BrN3S — CID 168534183
[(2-bromo-4-methylphenyl)methylideneamino]thiourea (PubChem CID 168534183) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is [(2-bromo-4-methylphenyl)methylideneamino]thiourea.
| Compound Name | [(2-bromo-4-methylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534183 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | [(2-bromo-4-methylphenyl)methylideneamino]thiourea |
| SMILES | Cc1ccc(C=NNC(N)=S)c(Br)c1 |
| InChI | InChI=1S/C9H10BrN3S/c1-6-2-3-7(8(10)4-6)5-12-13-9(11)14/h2-5H,1H3,(H3,11,13,14) |
| InChIKey | YOVIXFCJMCVATC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|