C11H13BrN4OS2 — CID 168536367
O-[5-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 168536367) has the molecular formula C11H13BrN4OS2 and a molecular weight of 361.29 g/mol. Its IUPAC name is O-[5-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[5-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 168536367 |
| Molecular Formula | C11H13BrN4OS2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | O-[5-bromo-2-[(carbamothioylhydrazinylidene)methyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1cc(Br)ccc1C=NNC(N)=S |
| InChI | InChI=1S/C11H13BrN4OS2/c1-16(2)11(19)17-9-5-8(12)4-3-7(9)6-14-15-10(13)18/h3-6H,1-2H3,(H3,13,15,18) |
| InChIKey | RSCSPEDHHRRKPP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|