C14H15BrN4OS2 — CID 168619521
O-[5-bromo-2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 168619521) has the molecular formula C14H15BrN4OS2 and a molecular weight of 399.34 g/mol. Its IUPAC name is O-[5-bromo-2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[5-bromo-2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 168619521 |
| Molecular Formula | C14H15BrN4OS2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | O-[5-bromo-2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1csc(NN=Cc2ccc(Br)cc2OC(=S)N(C)C)n1 |
| InChI | InChI=1S/C14H15BrN4OS2/c1-9-8-22-13(17-9)18-16-7-10-4-5-11(15)6-12(10)20-14(21)19(2)3/h4-8H,1-3H3,(H,17,18) |
| InChIKey | KIKRVFDYNDETMI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|