C16H7F5 — CID 145488519
1,3-difluoro-2-(3,4,5-trifluorophenyl)naphthalene (PubChem CID 145488519) has the molecular formula C16H7F5 and a molecular weight of 294.22 g/mol. Its IUPAC name is 1,3-difluoro-2-(3,4,5-trifluorophenyl)naphthalene.
| Compound Name | 1,3-difluoro-2-(3,4,5-trifluorophenyl)naphthalene |
|---|---|
| PubChem CID | 145488519 |
| Molecular Formula | C16H7F5 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1,3-difluoro-2-(3,4,5-trifluorophenyl)naphthalene |
| SMILES | Fc1cc(-c2c(F)cc3ccccc3c2F)cc(F)c1F |
| InChI | InChI=1S/C16H7F5/c17-11-5-8-3-1-2-4-10(8)15(20)14(11)9-6-12(18)16(21)13(19)7-9/h1-7H |
| InChIKey | UKQJBUBREHGDSY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|