C9H10F2O2 — CID 87961002
4,5-difluoro-3-propan-2-ylbenzene-1,2-diol (PubChem CID 87961002) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 4,5-difluoro-3-propan-2-ylbenzene-1,2-diol.
| Compound Name | 4,5-difluoro-3-propan-2-ylbenzene-1,2-diol |
|---|---|
| PubChem CID | 87961002 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4,5-difluoro-3-propan-2-ylbenzene-1,2-diol |
| SMILES | CC(C)c1c(O)c(O)cc(F)c1F |
| InChI | InChI=1S/C9H10F2O2/c1-4(2)7-8(11)5(10)3-6(12)9(7)13/h3-4,12-13H,1-2H3 |
| InChIKey | SNJKKRYMHUCPEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|