C9H10F2O — CID 130384199
3,4-difluoro-2-propan-2-ylphenol (PubChem CID 130384199) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is 3,4-difluoro-2-propan-2-ylphenol.
| Compound Name | 3,4-difluoro-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 130384199 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3,4-difluoro-2-propan-2-ylphenol |
| SMILES | CC(C)c1c(O)ccc(F)c1F |
| InChI | InChI=1S/C9H10F2O/c1-5(2)8-7(12)4-3-6(10)9(8)11/h3-5,12H,1-2H3 |
| InChIKey | WTFBAZODFFQNNC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |