C9H9F2NO2 — CID 84669836
2-amino-1-(2,3-difluoro-6-hydroxyphenyl)propan-1-one (PubChem CID 84669836) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is 2-amino-1-(2,3-difluoro-6-hydroxyphenyl)propan-1-one.
| Compound Name | 2-amino-1-(2,3-difluoro-6-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 84669836 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-amino-1-(2,3-difluoro-6-hydroxyphenyl)propan-1-one |
| SMILES | CC(N)C(=O)c1c(O)ccc(F)c1F |
| InChI | InChI=1S/C9H9F2NO2/c1-4(12)9(14)7-6(13)3-2-5(10)8(7)11/h2-4,13H,12H2,1H3 |
| InChIKey | MHQROSXRZTXDKZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |