C9H8ClF2NO2 — CID 84797727
2-amino-1-(3-chloro-4,5-difluoro-2-hydroxyphenyl)propan-1-one (PubChem CID 84797727) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-4,5-difluoro-2-hydroxyphenyl)propan-1-one.
| Compound Name | 2-amino-1-(3-chloro-4,5-difluoro-2-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 84797727 |
| Molecular Formula | C9H8ClF2NO2 |
| Molecular Weight | 235.62 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-amino-1-(3-chloro-4,5-difluoro-2-hydroxyphenyl)propan-1-one |
| SMILES | CC(N)C(=O)c1cc(F)c(F)c(Cl)c1O |
| InChI | InChI=1S/C9H8ClF2NO2/c1-3(13)8(14)4-2-5(11)7(12)6(10)9(4)15/h2-3,15H,13H2,1H3 |
| InChIKey | QEEZGPZQNKVHFQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|