About 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one
2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one (PubChem CID 84660437) has the molecular formula C8H8F2N2O
and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one |
| PubChem CID | 84660437 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one |
| SMILES | CC(N)C(=O)c1cc(F)ncc1F |
| InChI | InChI=1S/C8H8F2N2O/c1-4(11)8(13)5-2-7(10)12-3-6(5)9/h2-4H,11H2,1H3 |
| InChIKey | LNOPKRVVJWUBKP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one?
The IUPAC name of 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one (CID 84660437) is 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one.
What is the SMILES notation for 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one?
The canonical SMILES for 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one is CC(N)C(=O)c1cc(F)ncc1F.
What is the InChIKey of 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one?
The InChIKey is LNOPKRVVJWUBKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N2O/c1-4(11)8(13)5-2-7(10)12-3-6(5)9/h2-4H,11H2,1H3.
What are the key properties of 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one?
2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one has a molecular weight of 186.16 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,5-difluoro-4-pyridinyl)propan-1-one is sourced from PubChem (CID 84660437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).