C10H11F2NO — CID 126979999
1-(2,5-difluoro-4-pyridinyl)-3-methylbutan-1-one (PubChem CID 126979999) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-pyridinyl)-3-methylbutan-1-one.
| Compound Name | 1-(2,5-difluoro-4-pyridinyl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 126979999 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(2,5-difluoro-4-pyridinyl)-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)c1cc(F)ncc1F |
| InChI | InChI=1S/C10H11F2NO/c1-6(2)3-9(14)7-4-10(12)13-5-8(7)11/h4-6H,3H2,1-2H3 |
| InChIKey | ABYKDHHEYAAGFX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|