C9H7F2NO — CID 130542149
1-(2,5-difluoro-4-pyridinyl)-2-methylprop-2-en-1-one (PubChem CID 130542149) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-pyridinyl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(2,5-difluoro-4-pyridinyl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 130542149 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-(2,5-difluoro-4-pyridinyl)-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1cc(F)ncc1F |
| InChI | InChI=1S/C9H7F2NO/c1-5(2)9(13)6-3-8(11)12-4-7(6)10/h3-4H,1H2,2H3 |
| InChIKey | ZJEASWRLOZVGDC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|