C9H11F2NO2 — CID 84671264
2-(3-amino-1-hydroxypropyl)-3,4-difluorophenol (PubChem CID 84671264) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(3-amino-1-hydroxypropyl)-3,4-difluorophenol.
| Compound Name | 2-(3-amino-1-hydroxypropyl)-3,4-difluorophenol |
|---|---|
| PubChem CID | 84671264 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(3-amino-1-hydroxypropyl)-3,4-difluorophenol |
| SMILES | NCCC(O)c1c(O)ccc(F)c1F |
| InChI | InChI=1S/C9H11F2NO2/c10-5-1-2-6(13)8(9(5)11)7(14)3-4-12/h1-2,7,13-14H,3-4,12H2 |
| InChIKey | WBDWOSCQTBZFLI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |