C9H12FNO3 — CID 84776107
2-(3-amino-1-hydroxypropyl)-3-fluorobenzene-1,4-diol (PubChem CID 84776107) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is 2-(3-amino-1-hydroxypropyl)-3-fluorobenzene-1,4-diol.
| Compound Name | 2-(3-amino-1-hydroxypropyl)-3-fluorobenzene-1,4-diol |
|---|---|
| PubChem CID | 84776107 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(3-amino-1-hydroxypropyl)-3-fluorobenzene-1,4-diol |
| SMILES | NCCC(O)c1c(O)ccc(O)c1F |
| InChI | InChI=1S/C9H12FNO3/c10-9-7(14)2-1-5(12)8(9)6(13)3-4-11/h1-2,6,12-14H,3-4,11H2 |
| InChIKey | MMDRBCJVKWORFV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|