C17H16F2O2 — CID 175586719
4-fluoro-5-[2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol (PubChem CID 175586719) has the molecular formula C17H16F2O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is 4-fluoro-5-[2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol.
| Compound Name | 4-fluoro-5-[2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 175586719 |
| Molecular Formula | C17H16F2O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-fluoro-5-[2-(2-fluorophenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol |
| SMILES | CC(C)c1c(O)cc(C=Cc2ccccc2F)c(F)c1O |
| InChI | InChI=1S/C17H16F2O2/c1-10(2)15-14(20)9-12(16(19)17(15)21)8-7-11-5-3-4-6-13(11)18/h3-10,20-21H,1-2H3 |
| InChIKey | WIRZVQAWDLZEFE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|