About ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol
ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol (PubChem CID 176681357) has the molecular formula C21H30O2
and a molecular weight of 314.47 g/mol. Its IUPAC name is ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol.
Molecular Properties
| Compound Name | ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol |
| PubChem CID | 176681357 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol |
| SMILES | CC.CC.CC(C)c1c(O)cc(/C=C/c2ccccc2)cc1O |
| InChI | InChI=1S/C17H18O2.2C2H6/c1-12(2)17-15(18)10-14(11-16(17)19)9-8-13-6-4-3-5-7-13;2*1-2/h3-12,18-19H,1-2H3;2*1-2H3/b9-8+;; |
| InChIKey | MAOKPLZKVICIQV-YEUQMBKVSA-N |
| XLogP | 6.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol?
The IUPAC name of ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol (CID 176681357) is ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol.
What is the SMILES notation for ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol?
The canonical SMILES for ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol is CC.CC.CC(C)c1c(O)cc(/C=C/c2ccccc2)cc1O.
What is the InChIKey of ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol?
The InChIKey is MAOKPLZKVICIQV-YEUQMBKVSA-N. The full InChI is InChI=1S/C17H18O2.2C2H6/c1-12(2)17-15(18)10-14(11-16(17)19)9-8-13-6-4-3-5-7-13;2*1-2/h3-12,18-19H,1-2H3;2*1-2H3/b9-8+;;.
What are the key properties of ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol?
ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol has a molecular weight of 314.47 g/mol, XLogP of 6.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-[(E)-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol is sourced from PubChem (CID 176681357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).