C17H21N2O3P — CID 167457279
3-diaminophosphoryloxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenol (PubChem CID 167457279) has the molecular formula C17H21N2O3P and a molecular weight of 332.34 g/mol. Its IUPAC name is 3-diaminophosphoryloxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenol.
| Compound Name | 3-diaminophosphoryloxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 167457279 |
| Molecular Formula | C17H21N2O3P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-diaminophosphoryloxy-5-[(E)-2-phenylethenyl]-2-propan-2-ylphenol |
| SMILES | CC(C)c1c(O)cc(/C=C/c2ccccc2)cc1OP(N)(N)=O |
| InChI | InChI=1S/C17H21N2O3P/c1-12(2)17-15(20)10-14(11-16(17)22-23(18,19)21)9-8-13-6-4-3-5-7-13/h3-12,20H,1-2H3,(H4,18,19,21)/b9-8+ |
| InChIKey | PEQSXNXWAKFBGZ-CMDGGOBGSA-N |
| XLogP | 4.09 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|