C14H9F3 — CID 134146382
1,4-difluoro-2-[(E)-2-(2-fluorophenyl)ethenyl]benzene (PubChem CID 134146382) has the molecular formula C14H9F3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1,4-difluoro-2-[(E)-2-(2-fluorophenyl)ethenyl]benzene.
| Compound Name | 1,4-difluoro-2-[(E)-2-(2-fluorophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 134146382 |
| Molecular Formula | C14H9F3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1,4-difluoro-2-[(E)-2-(2-fluorophenyl)ethenyl]benzene |
| SMILES | Fc1ccc(F)c(/C=C/c2ccccc2F)c1 |
| InChI | InChI=1S/C14H9F3/c15-12-7-8-14(17)11(9-12)6-5-10-3-1-2-4-13(10)16/h1-9H/b6-5+ |
| InChIKey | YTGZKFWCFSGGEM-AATRIKPKSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|