C9H9F2N — CID 76997167
3-(2,5-difluorophenyl)prop-2-en-1-amine (PubChem CID 76997167) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)prop-2-en-1-amine.
| Compound Name | 3-(2,5-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 76997167 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-(2,5-difluorophenyl)prop-2-en-1-amine |
| SMILES | NCC=Cc1cc(F)ccc1F |
| InChI | InChI=1S/C9H9F2N/c10-8-3-4-9(11)7(6-8)2-1-5-12/h1-4,6H,5,12H2 |
| InChIKey | UQCFHOUDGDYKSC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |