C10H9ClF2O2S — CID 82487103
(E)-4-(2,5-difluorophenyl)but-3-ene-1-sulfonyl chloride (PubChem CID 82487103) has the molecular formula C10H9ClF2O2S and a molecular weight of 266.70 g/mol. Its IUPAC name is (E)-4-(2,5-difluorophenyl)but-3-ene-1-sulfonyl chloride.
| Compound Name | (E)-4-(2,5-difluorophenyl)but-3-ene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 82487103 |
| Molecular Formula | C10H9ClF2O2S |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | (E)-4-(2,5-difluorophenyl)but-3-ene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC/C=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C10H9ClF2O2S/c11-16(14,15)6-2-1-3-8-7-9(12)4-5-10(8)13/h1,3-5,7H,2,6H2/b3-1+ |
| InChIKey | JYQGBYMXIYHEGL-HNQUOIGGSA-N |
| XLogP | 2.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |