C12H14FNO — CID 117295806
(E)-3-(2-cyclopropyloxy-5-fluorophenyl)prop-2-en-1-amine (PubChem CID 117295806) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is (E)-3-(2-cyclopropyloxy-5-fluorophenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(2-cyclopropyloxy-5-fluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117295806 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (E)-3-(2-cyclopropyloxy-5-fluorophenyl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1cc(F)ccc1OC1CC1 |
| InChI | InChI=1S/C12H14FNO/c13-10-3-6-12(15-11-4-5-11)9(8-10)2-1-7-14/h1-3,6,8,11H,4-5,7,14H2/b2-1+ |
| InChIKey | ZSTYNVCBEFORLV-OWOJBTEDSA-N |
| XLogP | 2.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |