C14H18ClNO — CID 117382839
(E)-3-(3-chloro-4-cyclopentyloxyphenyl)prop-2-en-1-amine (PubChem CID 117382839) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-cyclopentyloxyphenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(3-chloro-4-cyclopentyloxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117382839 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (E)-3-(3-chloro-4-cyclopentyloxyphenyl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1ccc(OC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClNO/c15-13-10-11(4-3-9-16)7-8-14(13)17-12-5-1-2-6-12/h3-4,7-8,10,12H,1-2,5-6,9,16H2/b4-3+ |
| InChIKey | UDNHPYHPEHSQRH-ONEGZZNKSA-N |
| XLogP | 3.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |