C9H10ClFO3 — CID 117314997
5-chloro-4-fluoro-3-(1-hydroxypropan-2-yl)benzene-1,2-diol (PubChem CID 117314997) has the molecular formula C9H10ClFO3 and a molecular weight of 220.63 g/mol. Its IUPAC name is 5-chloro-4-fluoro-3-(1-hydroxypropan-2-yl)benzene-1,2-diol.
| Compound Name | 5-chloro-4-fluoro-3-(1-hydroxypropan-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117314997 |
| Molecular Formula | C9H10ClFO3 |
| Molecular Weight | 220.63 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 5-chloro-4-fluoro-3-(1-hydroxypropan-2-yl)benzene-1,2-diol |
| SMILES | CC(CO)c1c(O)c(O)cc(Cl)c1F |
| InChI | InChI=1S/C9H10ClFO3/c1-4(3-12)7-8(11)5(10)2-6(13)9(7)14/h2,4,12-14H,3H2,1H3 |
| InChIKey | WEZQFAGFUKLHJQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|