C9H9ClF2O — CID 117295344
2-(2-chloro-3,6-difluorophenyl)propan-1-ol (PubChem CID 117295344) has the molecular formula C9H9ClF2O and a molecular weight of 206.62 g/mol. Its IUPAC name is 2-(2-chloro-3,6-difluorophenyl)propan-1-ol.
| Compound Name | 2-(2-chloro-3,6-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 117295344 |
| Molecular Formula | C9H9ClF2O |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-(2-chloro-3,6-difluorophenyl)propan-1-ol |
| SMILES | CC(CO)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C9H9ClF2O/c1-5(4-13)8-6(11)2-3-7(12)9(8)10/h2-3,5,13H,4H2,1H3 |
| InChIKey | OAJNSXIWYPZHFE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|