C9H12Cl2FNO — CID 171209714
(2S)-2-amino-2-(2-chloro-6-fluoro-3-methylphenyl)ethanol;hydrochloride (PubChem CID 171209714) has the molecular formula C9H12Cl2FNO and a molecular weight of 240.10 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-chloro-6-fluoro-3-methylphenyl)ethanol;hydrochloride.
| Compound Name | (2S)-2-amino-2-(2-chloro-6-fluoro-3-methylphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171209714 |
| Molecular Formula | C9H12Cl2FNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (2S)-2-amino-2-(2-chloro-6-fluoro-3-methylphenyl)ethanol;hydrochloride |
| SMILES | Cc1ccc(F)c([C@H](N)CO)c1Cl.Cl |
| InChI | InChI=1S/C9H11ClFNO.ClH/c1-5-2-3-6(11)8(9(5)10)7(12)4-13;/h2-3,7,13H,4,12H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | DPXLVUDTKJYVRD-OGFXRTJISA-N |
| XLogP | 2.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |