C10H11Cl2FN2 — CID 171260075
(3S)-3-amino-3-(2-chloro-6-fluoro-3-methylphenyl)propanenitrile;hydrochloride (PubChem CID 171260075) has the molecular formula C10H11Cl2FN2 and a molecular weight of 249.12 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-chloro-6-fluoro-3-methylphenyl)propanenitrile;hydrochloride.
| Compound Name | (3S)-3-amino-3-(2-chloro-6-fluoro-3-methylphenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260075 |
| Molecular Formula | C10H11Cl2FN2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (3S)-3-amino-3-(2-chloro-6-fluoro-3-methylphenyl)propanenitrile;hydrochloride |
| SMILES | Cc1ccc(F)c([C@@H](N)CC#N)c1Cl.Cl |
| InChI | InChI=1S/C10H10ClFN2.ClH/c1-6-2-3-7(12)9(10(6)11)8(14)4-5-13;/h2-3,8H,4,14H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | BPCWJWHEMVJTGY-QRPNPIFTSA-N |
| XLogP | 3.12 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |