C9H12F2N2 — CID 55272041
1-(2,6-difluoro-3-methylphenyl)ethane-1,2-diamine (PubChem CID 55272041) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55272041 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(F)c(C(N)CN)c1F |
| InChI | InChI=1S/C9H12F2N2/c1-5-2-3-6(10)8(9(5)11)7(13)4-12/h2-3,7H,4,12-13H2,1H3 |
| InChIKey | NHPRDLWYUFUPCG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |