C9H7ClF2N2 — CID 130634209
(3R)-3-amino-3-(4-chloro-3,5-difluorophenyl)propanenitrile (PubChem CID 130634209) has the molecular formula C9H7ClF2N2 and a molecular weight of 216.62 g/mol. Its IUPAC name is (3R)-3-amino-3-(4-chloro-3,5-difluorophenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(4-chloro-3,5-difluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 130634209 |
| Molecular Formula | C9H7ClF2N2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (3R)-3-amino-3-(4-chloro-3,5-difluorophenyl)propanenitrile |
| SMILES | N#CC[C@@H](N)c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C9H7ClF2N2/c10-9-6(11)3-5(4-7(9)12)8(14)1-2-13/h3-4,8H,1,14H2/t8-/m1/s1 |
| InChIKey | HRDFZYQFDCXAMJ-MRVPVSSYSA-N |
| XLogP | 2.53 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|