C10H11ClF2O2 — CID 117345751
2-(3-chloro-2,6-difluoro-4-methoxyphenyl)propan-1-ol (PubChem CID 117345751) has the molecular formula C10H11ClF2O2 and a molecular weight of 236.64 g/mol. Its IUPAC name is 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)propan-1-ol.
| Compound Name | 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117345751 |
| Molecular Formula | C10H11ClF2O2 |
| Molecular Weight | 236.64 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(3-chloro-2,6-difluoro-4-methoxyphenyl)propan-1-ol |
| SMILES | COc1cc(F)c(C(C)CO)c(F)c1Cl |
| InChI | InChI=1S/C10H11ClF2O2/c1-5(4-14)8-6(12)3-7(15-2)9(11)10(8)13/h3,5,14H,4H2,1-2H3 |
| InChIKey | ZOCGFUNUWICSOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|