C6H4F3NO — CID 19957203
6-amino-2,3,4-trifluorophenol (PubChem CID 19957203) has the molecular formula C6H4F3NO and a molecular weight of 163.10 g/mol. Its IUPAC name is 6-amino-2,3,4-trifluorophenol.
| Compound Name | 6-amino-2,3,4-trifluorophenol |
|---|---|
| PubChem CID | 19957203 |
| Molecular Formula | C6H4F3NO |
| Molecular Weight | 163.10 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 6-amino-2,3,4-trifluorophenol |
| SMILES | Nc1cc(F)c(F)c(F)c1O |
| InChI | InChI=1S/C6H4F3NO/c7-2-1-3(10)6(11)5(9)4(2)8/h1,11H,10H2 |
| InChIKey | VEPKZQHPDWUTBU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.10 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|