C7H7F2NO2 — CID 84766766
4-amino-2,6-difluoro-3-methoxyphenol (PubChem CID 84766766) has the molecular formula C7H7F2NO2 and a molecular weight of 175.13 g/mol. Its IUPAC name is 4-amino-2,6-difluoro-3-methoxyphenol.
| Compound Name | 4-amino-2,6-difluoro-3-methoxyphenol |
|---|---|
| PubChem CID | 84766766 |
| Molecular Formula | C7H7F2NO2 |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 4-amino-2,6-difluoro-3-methoxyphenol |
| SMILES | COc1c(N)cc(F)c(O)c1F |
| InChI | InChI=1S/C7H7F2NO2/c1-12-7-4(10)2-3(8)6(11)5(7)9/h2,11H,10H2,1H3 |
| InChIKey | OANRZEADQWKERU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|