C8H6F2O3 — CID 84770629
3,5-difluoro-2-hydroxy-4-methoxybenzaldehyde (PubChem CID 84770629) has the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. Its IUPAC name is 3,5-difluoro-2-hydroxy-4-methoxybenzaldehyde.
| Compound Name | 3,5-difluoro-2-hydroxy-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 84770629 |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 3,5-difluoro-2-hydroxy-4-methoxybenzaldehyde |
| SMILES | COc1c(F)cc(C=O)c(O)c1F |
| InChI | InChI=1S/C8H6F2O3/c1-13-8-5(9)2-4(3-11)7(12)6(8)10/h2-3,12H,1H3 |
| InChIKey | UBHDUBAAQFQMBU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|