C10H11FO4 — CID 117275489
3-fluoro-2,4,5-trimethoxybenzaldehyde (PubChem CID 117275489) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is 3-fluoro-2,4,5-trimethoxybenzaldehyde.
| Compound Name | 3-fluoro-2,4,5-trimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117275489 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-fluoro-2,4,5-trimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(OC)c(F)c1OC |
| InChI | InChI=1S/C10H11FO4/c1-13-7-4-6(5-12)9(14-2)8(11)10(7)15-3/h4-5H,1-3H3 |
| InChIKey | AXEVXUGXCORAAN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|