About [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin
[5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin (PubChem CID 174370211) has the molecular formula C11H14O3Sn2
and a molecular weight of 431.65 g/mol. Its IUPAC name is [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin.
Molecular Properties
| Compound Name | [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin |
| PubChem CID | 174370211 |
| Molecular Formula | C11H14O3Sn2 |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin |
| SMILES | COc1cc(C=O)c([Sn]C)c([Sn]C)c1OC |
| InChI | InChI=1S/C9H8O3.2CH3.2Sn/c1-11-8-4-3-7(6-10)5-9(8)12-2;;;;/h5-6H,1-2H3;2*1H3;; |
| InChIKey | AKWSJIUSHQMWKW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin?
The IUPAC name of [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin (CID 174370211) is [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin.
What is the SMILES notation for [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin?
The canonical SMILES for [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin is COc1cc(C=O)c([Sn]C)c([Sn]C)c1OC.
What is the InChIKey of [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin?
The InChIKey is AKWSJIUSHQMWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.2CH3.2Sn/c1-11-8-4-3-7(6-10)5-9(8)12-2;;;;/h5-6H,1-2H3;2*1H3;;.
What are the key properties of [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin?
[5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin has a molecular weight of 431.65 g/mol, XLogP of 0.27, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-formyl-2,3-dimethoxy-6-(methyl-λ2-stannanyl)phenyl]-methyltin is sourced from PubChem (CID 174370211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).