C14H21BrO6 — CID 88526505
2-bromo-3,4,5-trimethoxybenzaldehyde;1,1-dimethoxyethane (PubChem CID 88526505) has the molecular formula C14H21BrO6 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-bromo-3,4,5-trimethoxybenzaldehyde;1,1-dimethoxyethane.
| Compound Name | 2-bromo-3,4,5-trimethoxybenzaldehyde;1,1-dimethoxyethane |
|---|---|
| PubChem CID | 88526505 |
| Molecular Formula | C14H21BrO6 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-bromo-3,4,5-trimethoxybenzaldehyde;1,1-dimethoxyethane |
| SMILES | COC(C)OC.COc1cc(C=O)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C10H11BrO4.C4H10O2/c1-13-7-4-6(5-12)8(11)10(15-3)9(7)14-2;1-4(5-2)6-3/h4-5H,1-3H3;4H,1-3H3 |
| InChIKey | KRLBPDZFVXAERR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|