C11H15BrN4O3 — CID 91364850
2-[(2-bromo-3,4,5-trimethoxyphenyl)methylideneamino]guanidine (PubChem CID 91364850) has the molecular formula C11H15BrN4O3 and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-[(2-bromo-3,4,5-trimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(2-bromo-3,4,5-trimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 91364850 |
| Molecular Formula | C11H15BrN4O3 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[(2-bromo-3,4,5-trimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(C=NN=C(N)N)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C11H15BrN4O3/c1-17-7-4-6(5-15-16-11(13)14)8(12)10(19-3)9(7)18-2/h4-5H,1-3H3,(H4,13,14,16) |
| InChIKey | KISCLZBVUSOLBV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|