C11H16N4O2S — CID 168592679
2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methylideneamino]guanidine (PubChem CID 168592679) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592679 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(SC)c(OC)cc1C=NN=C(N)N |
| InChI | InChI=1S/C11H16N4O2S/c1-16-8-5-10(18-3)9(17-2)4-7(8)6-14-15-11(12)13/h4-6H,1-3H3,(H4,12,13,15) |
| InChIKey | BVTUHRHOLPTMAA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|