C18H24N4O6S — CID 158713821
4-methylbenzenesulfonic acid;2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine (PubChem CID 158713821) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 4-methylbenzenesulfonic acid;2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 158713821 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(OC)c(OC)cc1C=NN=C(N)N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H16N4O3.C7H8O3S/c1-16-8-5-10(18-3)9(17-2)4-7(8)6-14-15-11(12)13;1-6-2-4-7(5-3-6)11(8,9)10/h4-6H,1-3H3,(H4,12,13,15);2-5H,1H3,(H,8,9,10) |
| InChIKey | IJBDDCKKBAKCBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|