C18H24N4O7S — CID 172940204
1-hydroxy-2-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid (PubChem CID 172940204) has the molecular formula C18H24N4O7S and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid.
| Compound Name | 1-hydroxy-2-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172940204 |
| Molecular Formula | C18H24N4O7S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-hydroxy-2-[(E)-(2,4,6-trimethoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid |
| SMILES | COc1cc(OC)c(/C=N/N=C(N)NO)c(OC)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H16N4O4.C7H8O3S/c1-17-7-4-9(18-2)8(10(5-7)19-3)6-13-14-11(12)15-16;1-6-2-4-7(5-3-6)11(8,9)10/h4-6,16H,1-3H3,(H3,12,14,15);2-5H,1H3,(H,8,9,10)/b13-6+; |
| InChIKey | XKCYXAAFDWLLLF-AWFSDRIXSA-N |
| XLogP | 1.58 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|