C16H20N4O6S — CID 10157572
1-hydroxy-2-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid (PubChem CID 10157572) has the molecular formula C16H20N4O6S and a molecular weight of 396.43 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid.
| Compound Name | 1-hydroxy-2-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 10157572 |
| Molecular Formula | C16H20N4O6S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-hydroxy-2-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]guanidine;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(/C=N/N=C(/N)NO)cc1O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H12N4O3.C7H8O3S/c1-16-8-3-2-6(4-7(8)14)5-11-12-9(10)13-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,14-15H,1H3,(H3,10,12,13);2-5H,1H3,(H,8,9,10)/b11-5+; |
| InChIKey | YNXZNJZUTSAYBH-HMXKFKBXSA-N |
| XLogP | 1.27 |
| TPSA | 166.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|