C18H23BrN4O7S — CID 173023876
2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (PubChem CID 173023876) has the molecular formula C18H23BrN4O7S and a molecular weight of 519.37 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173023876 |
| Molecular Formula | C18H23BrN4O7S |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| SMILES | COc1c(Br)cc(/C=N/N=C(N)NO)c(OC)c1OC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H15BrN4O4.C7H8O3S/c1-18-8-6(5-14-15-11(13)16-17)4-7(12)9(19-2)10(8)20-3;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,17H,1-3H3,(H3,13,15,16);2-5H,1H3,(H,8,9,10)/b14-5+; |
| InChIKey | ZCZOZGSMJLYWAY-OCSIRBNJSA-N |
| XLogP | 2.34 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|