C17H20N6O10S — CID 10300601
2-[(E)-(2,3-dimethoxy-5,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (PubChem CID 10300601) has the molecular formula C17H20N6O10S and a molecular weight of 500.45 g/mol. Its IUPAC name is 2-[(E)-(2,3-dimethoxy-5,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(E)-(2,3-dimethoxy-5,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 10300601 |
| Molecular Formula | C17H20N6O10S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 2-[(E)-(2,3-dimethoxy-5,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| SMILES | COc1cc([N+](=O)[O-])c([N+](=O)[O-])c(/C=N/N=C(/N)NO)c1OC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H12N6O7.C7H8O3S/c1-22-7-3-6(15(18)19)8(16(20)21)5(9(7)23-2)4-12-13-10(11)14-17;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,17H,1-2H3,(H3,11,13,14);2-5H,1H3,(H,8,9,10)/b12-4+; |
| InChIKey | NEJXNPHKYCLVGI-AQCBZIOHSA-N |
| XLogP | 1.39 |
| TPSA | 242.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|