C15H15ClN6O8S — CID 139982908
2-[(E)-(3-chloro-2,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (PubChem CID 139982908) has the molecular formula C15H15ClN6O8S and a molecular weight of 474.84 g/mol. Its IUPAC name is 2-[(E)-(3-chloro-2,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(E)-(3-chloro-2,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 139982908 |
| Molecular Formula | C15H15ClN6O8S |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2-[(E)-(3-chloro-2,6-dinitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N/C(=N\N=C\c1c([N+](=O)[O-])ccc(Cl)c1[N+](=O)[O-])NO |
| InChI | InChI=1S/C8H7ClN6O5.C7H8O3S/c9-5-1-2-6(14(17)18)4(7(5)15(19)20)3-11-12-8(10)13-16;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,16H,(H3,10,12,13);2-5H,1H3,(H,8,9,10)/b11-3+; |
| InChIKey | HBBOWUBHGJAJBO-KODGKZAJSA-N |
| XLogP | 2.03 |
| TPSA | 223.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|