C15H16ClN5O6S — CID 85326105
2-[(5-chloro-2-nitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (PubChem CID 85326105) has the molecular formula C15H16ClN5O6S and a molecular weight of 429.84 g/mol. Its IUPAC name is 2-[(5-chloro-2-nitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(5-chloro-2-nitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 85326105 |
| Molecular Formula | C15H16ClN5O6S |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 2-[(5-chloro-2-nitrophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(=NN=Cc1cc(Cl)ccc1[N+](=O)[O-])NO |
| InChI | InChI=1S/C8H8ClN5O3.C7H8O3S/c9-6-1-2-7(14(16)17)5(3-6)4-11-12-8(10)13-15;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,15H,(H3,10,12,13);2-5H,1H3,(H,8,9,10) |
| InChIKey | OWVMMCDWLOSJHS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 180.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|