C15H14ClN5O5S — CID 173023971
[[N'-[(4-chloro-2-nitrophenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate (PubChem CID 173023971) has the molecular formula C15H14ClN5O5S and a molecular weight of 411.83 g/mol. Its IUPAC name is [[N'-[(4-chloro-2-nitrophenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[N'-[(4-chloro-2-nitrophenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173023971 |
| Molecular Formula | C15H14ClN5O5S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [[N'-[(4-chloro-2-nitrophenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONC(N)=NN=Cc2ccc(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14ClN5O5S/c1-10-2-6-13(7-3-10)27(24,25)26-20-15(17)19-18-9-11-4-5-12(16)8-14(11)21(22)23/h2-9H,1H3,(H3,17,19,20) |
| InChIKey | NMSXNIOMQVUURJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|