C18H22N4O6S — CID 173023928
[[N'-[(3,4,5-trimethoxyphenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate (PubChem CID 173023928) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is [[N'-[(3,4,5-trimethoxyphenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[N'-[(3,4,5-trimethoxyphenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173023928 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [[N'-[(3,4,5-trimethoxyphenyl)methylideneamino]carbamimidoyl]amino] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C=NN=C(N)NOS(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N4O6S/c1-12-5-7-14(8-6-12)29(23,24)28-22-18(19)21-20-11-13-9-15(25-2)17(27-4)16(10-13)26-3/h5-11H,1-4H3,(H3,19,21,22) |
| InChIKey | YYOOBPLEZSTICG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|