C8H7ClN6O5 — CID 10277141
2-[(E)-(6-chloro-2,3-dinitrophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 10277141) has the molecular formula C8H7ClN6O5 and a molecular weight of 302.63 g/mol. Its IUPAC name is 2-[(E)-(6-chloro-2,3-dinitrophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(6-chloro-2,3-dinitrophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 10277141 |
| Molecular Formula | C8H7ClN6O5 |
| Molecular Weight | 302.63 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-[(E)-(6-chloro-2,3-dinitrophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | N/C(=N/N=C/c1c(Cl)ccc([N+](=O)[O-])c1[N+](=O)[O-])NO |
| InChI | InChI=1S/C8H7ClN6O5/c9-5-1-2-6(14(17)18)7(15(19)20)4(5)3-11-12-8(10)13-16/h1-3,16H,(H3,10,12,13)/b11-3+ |
| InChIKey | XMQLXSZNJHKWLS-QDEBKDIKSA-N |
| XLogP | 0.78 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.63 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|