C11H16N4O4 — CID 5494118
1-hydroxy-2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine (PubChem CID 5494118) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-hydroxy-2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 1-hydroxy-2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 5494118 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-hydroxy-2-[(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(OC)c(OC)cc1C=N/N=C(/N)NO |
| InChI | InChI=1S/C11H16N4O4/c1-17-8-5-10(19-3)9(18-2)4-7(8)6-13-14-11(12)15-16/h4-6,16H,1-3H3,(H3,12,14,15) |
| InChIKey | AXLNFFUCIUXDJD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|