C14H21ClN4O4 — CID 173223391
2-[(E)-(2-chloro-3,4,5-triethoxyphenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 173223391) has the molecular formula C14H21ClN4O4 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-[(E)-(2-chloro-3,4,5-triethoxyphenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(2-chloro-3,4,5-triethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 173223391 |
| Molecular Formula | C14H21ClN4O4 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[(E)-(2-chloro-3,4,5-triethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | CCOc1cc(/C=N/N=C(N)NO)c(Cl)c(OCC)c1OCC |
| InChI | InChI=1S/C14H21ClN4O4/c1-4-21-10-7-9(8-17-18-14(16)19-20)11(15)13(23-6-3)12(10)22-5-2/h7-8,20H,4-6H2,1-3H3,(H3,16,18,19)/b17-8+ |
| InChIKey | VSAAXSMDKWITCA-CAOOACKPSA-N |
| XLogP | 2.16 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|